C60H49N — CID 144624203
N-[3,6-bis[4-(8,9-dihydro-7H-fluoren-3-yl)phenyl]-2-methylphenyl]-1-(8,9-dihydro-7H-fluoren-3-yl)ethanimine (PubChem CID 144624203) has the molecular formula C60H49N and a molecular weight of 784.06 g/mol. Its IUPAC name is N-[3,6-bis[4-(8,9-dihydro-7H-fluoren-3-yl)phenyl]-2-methylphenyl]-1-(8,9-dihydro-7H-fluoren-3-yl)ethanimine.
| Compound Name | N-[3,6-bis[4-(8,9-dihydro-7H-fluoren-3-yl)phenyl]-2-methylphenyl]-1-(8,9-dihydro-7H-fluoren-3-yl)ethanimine |
|---|---|
| PubChem CID | 144624203 |
| Molecular Formula | C60H49N |
| Molecular Weight | 784.06 g/mol |
| Exact Mass | 783.39 |
| IUPAC Name | N-[3,6-bis[4-(8,9-dihydro-7H-fluoren-3-yl)phenyl]-2-methylphenyl]-1-(8,9-dihydro-7H-fluoren-3-yl)ethanimine |
| SMILES | C/C(=N\c1c(-c2ccc(-c3ccc4c(c3)C3=C(CCC=C3)C4)cc2)ccc(-c2ccc(-c3ccc4c(c3)C3=C(CCC=C3)C4)cc2)c1C)c1ccc2c(c1)C1=C(CCC=C1)C2 |
| InChI | InChI=1S/C60H49N/c1-37-52(41-19-15-39(16-20-41)44-24-27-50-32-47-10-4-7-13-54(47)58(50)35-44)29-30-56(60(37)61-38(2)43-23-26-49-31-46-9-3-6-12-53(46)57(49)34-43)42-21-17-40(18-22-42)45-25-28-51-33-48-11-5-8-14-55(48)59(51)36-45/h6-8,12-30,34-36H,3-5,9-11,31-33H2,1-2H3/b61-38+ |
| InChIKey | ASHNERBODJTTKU-VEYWZFBVSA-N |
| XLogP | 15.78 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.06 |
| LogP ≤ 5 | 15.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|