C41H48N8O7 — CID 144627327
1-[(E)-3-imino-4-methyl-1-(4-methylanilino)pent-1-enyl]-3-[5-[2-[3-methoxy-5-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]anilino]pyrimidin-4-yl]oxyquinolin-8-yl]urea (PubChem CID 144627327) has the molecular formula C41H48N8O7 and a molecular weight of 764.88 g/mol. Its IUPAC name is 1-[(E)-3-imino-4-methyl-1-(4-methylanilino)pent-1-enyl]-3-[5-[2-[3-methoxy-5-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]anilino]pyrimidin-4-yl]oxyquinolin-8-yl]urea.
| Compound Name | 1-[(E)-3-imino-4-methyl-1-(4-methylanilino)pent-1-enyl]-3-[5-[2-[3-methoxy-5-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]anilino]pyrimidin-4-yl]oxyquinolin-8-yl]urea |
|---|---|
| PubChem CID | 144627327 |
| Molecular Formula | C41H48N8O7 |
| Molecular Weight | 764.88 g/mol |
| Exact Mass | 764.36 |
| IUPAC Name | 1-[(E)-3-imino-4-methyl-1-(4-methylanilino)pent-1-enyl]-3-[5-[2-[3-methoxy-5-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]anilino]pyrimidin-4-yl]oxyquinolin-8-yl]urea |
| SMILES | [H]/N=C(/C=C(/NC(=O)Nc1ccc(Oc2ccnc(Nc3cc(OC)cc(OCCOCCOCCOC)c3)n2)c2cccnc12)Nc1ccc(C)cc1)C(C)C |
| InChI | InChI=1S/C41H48N8O7/c1-27(2)34(42)26-37(45-29-10-8-28(3)9-11-29)48-41(50)47-35-12-13-36(33-7-6-15-43-39(33)35)56-38-14-16-44-40(49-38)46-30-23-31(52-5)25-32(24-30)55-22-21-54-20-19-53-18-17-51-4/h6-16,23-27,42,45H,17-22H2,1-5H3,(H,44,46,49)(H2,47,48,50)/b37-26+,42-34- |
| InChIKey | ZQDCVJLPMFFCST-NDTWRUIYSA-N |
| XLogP | 7.69 |
| TPSA | 183.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.88 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|