C18H14ClN5 — CID 144630511
4-[6-(6-chloro-3-pyridinyl)imidazo[1,2-a]pyrazin-3-yl]-N-methylaniline (PubChem CID 144630511) has the molecular formula C18H14ClN5 and a molecular weight of 335.80 g/mol. Its IUPAC name is 4-[6-(6-chloro-3-pyridinyl)imidazo[1,2-a]pyrazin-3-yl]-N-methylaniline.
| Compound Name | 4-[6-(6-chloro-3-pyridinyl)imidazo[1,2-a]pyrazin-3-yl]-N-methylaniline |
|---|---|
| PubChem CID | 144630511 |
| Molecular Formula | C18H14ClN5 |
| Molecular Weight | 335.80 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 4-[6-(6-chloro-3-pyridinyl)imidazo[1,2-a]pyrazin-3-yl]-N-methylaniline |
| SMILES | CNc1ccc(-c2cnc3cnc(-c4ccc(Cl)nc4)cn23)cc1 |
| InChI | InChI=1S/C18H14ClN5/c1-20-14-5-2-12(3-6-14)16-9-23-18-10-21-15(11-24(16)18)13-4-7-17(19)22-8-13/h2-11,20H,1H3 |
| InChIKey | DKEWBAXNIAPFPI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.80 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|