C19H11ClN4 — CID 155568839
4-[6-(3-chlorophenyl)imidazo[1,2-a]pyrazin-3-yl]benzonitrile (PubChem CID 155568839) has the molecular formula C19H11ClN4 and a molecular weight of 330.78 g/mol. Its IUPAC name is 4-[6-(3-chlorophenyl)imidazo[1,2-a]pyrazin-3-yl]benzonitrile.
| Compound Name | 4-[6-(3-chlorophenyl)imidazo[1,2-a]pyrazin-3-yl]benzonitrile |
|---|---|
| PubChem CID | 155568839 |
| Molecular Formula | C19H11ClN4 |
| Molecular Weight | 330.78 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 4-[6-(3-chlorophenyl)imidazo[1,2-a]pyrazin-3-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2cnc3cnc(-c4cccc(Cl)c4)cn23)cc1 |
| InChI | InChI=1S/C19H11ClN4/c20-16-3-1-2-15(8-16)17-12-24-18(10-23-19(24)11-22-17)14-6-4-13(9-21)5-7-14/h1-8,10-12H |
| InChIKey | LPTJSSPCZRKJPB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.78 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |