C31H34N8O2S2 — CID 144630672
N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-2-(1H-indol-3-yl)acetamide;3-ethyl-1H-indole;N-(1,3,4-thiadiazol-2-yl)formamide (PubChem CID 144630672) has the molecular formula C31H34N8O2S2 and a molecular weight of 614.80 g/mol. Its IUPAC name is N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-2-(1H-indol-3-yl)acetamide;3-ethyl-1H-indole;N-(1,3,4-thiadiazol-2-yl)formamide.
| Compound Name | N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-2-(1H-indol-3-yl)acetamide;3-ethyl-1H-indole;N-(1,3,4-thiadiazol-2-yl)formamide |
|---|---|
| PubChem CID | 144630672 |
| Molecular Formula | C31H34N8O2S2 |
| Molecular Weight | 614.80 g/mol |
| Exact Mass | 614.22 |
| IUPAC Name | N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-2-(1H-indol-3-yl)acetamide;3-ethyl-1H-indole;N-(1,3,4-thiadiazol-2-yl)formamide |
| SMILES | CCc1c[nH]c2ccccc12.O=C(Cc1c[nH]c2ccccc12)Nc1nnc(C2CCCCC2)s1.O=CNc1nncs1 |
| InChI | InChI=1S/C18H20N4OS.C10H11N.C3H3N3OS/c23-16(10-13-11-19-15-9-5-4-8-14(13)15)20-18-22-21-17(24-18)12-6-2-1-3-7-12;1-2-8-7-11-10-6-4-3-5-9(8)10;7-1-4-3-6-5-2-8-3/h4-5,8-9,11-12,19H,1-3,6-7,10H2,(H,20,22,23);3-7,11H,2H2,1H3;1-2H,(H,4,6,7) |
| InChIKey | DDJOCZHNGJLKMU-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 141.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.80 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|