C32H35NO9 — CID 14463123
(4,17-diacetyloxy-7-formyl-18-hydroxy-7,10-dimethyl-15-methylidene-13-oxo-10-azahexacyclo[7.7.1.12,14.01,12.03,8.03,11]octadecan-5-yl) benzoate (PubChem CID 14463123) has the molecular formula C32H35NO9 and a molecular weight of 577.63 g/mol. Its IUPAC name is (4,17-diacetyloxy-7-formyl-18-hydroxy-7,10-dimethyl-15-methylidene-13-oxo-10-azahexacyclo[7.7.1.12,14.01,12.03,8.03,11]octadecan-5-yl) benzoate.
| Compound Name | (4,17-diacetyloxy-7-formyl-18-hydroxy-7,10-dimethyl-15-methylidene-13-oxo-10-azahexacyclo[7.7.1.12,14.01,12.03,8.03,11]octadecan-5-yl) benzoate |
|---|---|
| PubChem CID | 14463123 |
| Molecular Formula | C32H35NO9 |
| Molecular Weight | 577.63 g/mol |
| Exact Mass | 577.23 |
| IUPAC Name | (4,17-diacetyloxy-7-formyl-18-hydroxy-7,10-dimethyl-15-methylidene-13-oxo-10-azahexacyclo[7.7.1.12,14.01,12.03,8.03,11]octadecan-5-yl) benzoate |
| SMILES | C=C1CC23C(OC(C)=O)C4C5C(C)(C=O)CC(OC(=O)c6ccccc6)C(OC(C)=O)C56C(C2C(=O)C1C(O)C36)N4C |
| InChI | InChI=1S/C32H35NO9/c1-14-11-31-20-22(37)19(14)23(38)25(31)32-24(21(33(5)26(20)32)28(31)41-16(3)36)30(4,13-34)12-18(27(32)40-15(2)35)42-29(39)17-9-7-6-8-10-17/h6-10,13,18-21,23-28,38H,1,11-12H2,2-5H3 |
| InChIKey | REQUJTKBFQSUNF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 136.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.63 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|