C26H34O6 — CID 162924160
[(1R,2R,4aS,5R,6R,8aR)-5,6-diacetyloxy-4a-methyl-8-methylidene-2-propan-2-yl-1,2,3,4,5,6,7,8a-octahydronaphthalen-1-yl] benzoate (PubChem CID 162924160) has the molecular formula C26H34O6 and a molecular weight of 442.55 g/mol. Its IUPAC name is [(1R,2R,4aS,5R,6R,8aR)-5,6-diacetyloxy-4a-methyl-8-methylidene-2-propan-2-yl-1,2,3,4,5,6,7,8a-octahydronaphthalen-1-yl] benzoate.
| Compound Name | [(1R,2R,4aS,5R,6R,8aR)-5,6-diacetyloxy-4a-methyl-8-methylidene-2-propan-2-yl-1,2,3,4,5,6,7,8a-octahydronaphthalen-1-yl] benzoate |
|---|---|
| PubChem CID | 162924160 |
| Molecular Formula | C26H34O6 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | [(1R,2R,4aS,5R,6R,8aR)-5,6-diacetyloxy-4a-methyl-8-methylidene-2-propan-2-yl-1,2,3,4,5,6,7,8a-octahydronaphthalen-1-yl] benzoate |
| SMILES | C=C1C[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@]2(C)CC[C@H](C(C)C)[C@@H](OC(=O)c3ccccc3)[C@H]12 |
| InChI | InChI=1S/C26H34O6/c1-15(2)20-12-13-26(6)22(23(20)32-25(29)19-10-8-7-9-11-19)16(3)14-21(30-17(4)27)24(26)31-18(5)28/h7-11,15,20-24H,3,12-14H2,1-2,4-6H3/t20-,21-,22+,23-,24+,26+/m1/s1 |
| InChIKey | JZUQIIZXUMLRBA-CUMUNZOQSA-N |
| XLogP | 4.72 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|