C43H45NO13 — CID 72809453
(4,16,17,18-tetraacetyloxy-13-benzoyloxy-7-formyl-7,10-dimethyl-15-methylidene-10-azahexacyclo[7.7.1.12,14.01,12.03,8.03,11]octadecan-5-yl) benzoate (PubChem CID 72809453) has the molecular formula C43H45NO13 and a molecular weight of 783.83 g/mol. Its IUPAC name is (4,16,17,18-tetraacetyloxy-13-benzoyloxy-7-formyl-7,10-dimethyl-15-methylidene-10-azahexacyclo[7.7.1.12,14.01,12.03,8.03,11]octadecan-5-yl) benzoate.
| Compound Name | (4,16,17,18-tetraacetyloxy-13-benzoyloxy-7-formyl-7,10-dimethyl-15-methylidene-10-azahexacyclo[7.7.1.12,14.01,12.03,8.03,11]octadecan-5-yl) benzoate |
|---|---|
| PubChem CID | 72809453 |
| Molecular Formula | C43H45NO13 |
| Molecular Weight | 783.83 g/mol |
| Exact Mass | 783.29 |
| IUPAC Name | (4,16,17,18-tetraacetyloxy-13-benzoyloxy-7-formyl-7,10-dimethyl-15-methylidene-10-azahexacyclo[7.7.1.12,14.01,12.03,8.03,11]octadecan-5-yl) benzoate |
| SMILES | C=C1C2C(OC(=O)c3ccccc3)C3C4N(C)C5C(OC(C)=O)C3(C1OC(C)=O)C(C2OC(C)=O)C41C(OC(C)=O)C(OC(=O)c2ccccc2)CC(C)(C=O)C51 |
| InChI | InChI=1S/C43H45NO13/c1-20-28-31(57-40(51)26-16-12-9-13-17-26)29-35-43-33(41(6,19-45)18-27(37(43)54-23(4)48)56-39(50)25-14-10-8-11-15-25)30(44(35)7)38(55-24(5)49)42(29,36(20)53-22(3)47)34(43)32(28)52-21(2)46/h8-17,19,27-38H,1,18H2,2-7H3 |
| InChIKey | FLSBFMBABBMGJC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 178.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.83 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|