C32H49NO — CID 144632079
(1E,3Z)-5-(2-tert-butylphenyl)-3-methyl-2-phenylpenta-1,3-dien-1-amine;ethane;(Z)-2-methoxy-4-methylhex-2-ene (PubChem CID 144632079) has the molecular formula C32H49NO and a molecular weight of 463.75 g/mol. Its IUPAC name is (1E,3Z)-5-(2-tert-butylphenyl)-3-methyl-2-phenylpenta-1,3-dien-1-amine;ethane;(Z)-2-methoxy-4-methylhex-2-ene.
| Compound Name | (1E,3Z)-5-(2-tert-butylphenyl)-3-methyl-2-phenylpenta-1,3-dien-1-amine;ethane;(Z)-2-methoxy-4-methylhex-2-ene |
|---|---|
| PubChem CID | 144632079 |
| Molecular Formula | C32H49NO |
| Molecular Weight | 463.75 g/mol |
| Exact Mass | 463.38 |
| IUPAC Name | (1E,3Z)-5-(2-tert-butylphenyl)-3-methyl-2-phenylpenta-1,3-dien-1-amine;ethane;(Z)-2-methoxy-4-methylhex-2-ene |
| SMILES | CC.CC(=C/Cc1ccccc1C(C)(C)C)/C(=C\N)c1ccccc1.CCC(C)/C=C(/C)OC |
| InChI | InChI=1S/C22H27N.C8H16O.C2H6/c1-17(20(16-23)18-10-6-5-7-11-18)14-15-19-12-8-9-13-21(19)22(2,3)4;1-5-7(2)6-8(3)9-4;1-2/h5-14,16H,15,23H2,1-4H3;6-7H,5H2,1-4H3;1-2H3/b17-14-,20-16+;8-6-; |
| InChIKey | BXTFXGFSNQUMBD-XTYDHNORSA-N |
| XLogP | 9.08 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.75 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|