C20H23N — CID 146631347
(2E,4Z)-N-methyl-1-(2-methylphenyl)-4-phenylhexa-2,4-dien-3-amine (PubChem CID 146631347) has the molecular formula C20H23N and a molecular weight of 277.41 g/mol. Its IUPAC name is (2E,4Z)-N-methyl-1-(2-methylphenyl)-4-phenylhexa-2,4-dien-3-amine.
| Compound Name | (2E,4Z)-N-methyl-1-(2-methylphenyl)-4-phenylhexa-2,4-dien-3-amine |
|---|---|
| PubChem CID | 146631347 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | (2E,4Z)-N-methyl-1-(2-methylphenyl)-4-phenylhexa-2,4-dien-3-amine |
| SMILES | C/C=C(C(=C/Cc1ccccc1C)\NC)/c1ccccc1 |
| InChI | InChI=1S/C20H23N/c1-4-19(18-12-6-5-7-13-18)20(21-3)15-14-17-11-9-8-10-16(17)2/h4-13,15,21H,14H2,1-3H3/b19-4-,20-15+ |
| InChIKey | SXVGDJGWLOOTCQ-QBQZRFGLSA-N |
| XLogP | 4.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|