About ethane;methyl 1-(4-methylphenyl)-1,2,4-triazole-3-carboxylate
ethane;methyl 1-(4-methylphenyl)-1,2,4-triazole-3-carboxylate (PubChem CID 144636551) has the molecular formula C13H17N3O2
and a molecular weight of 247.30 g/mol. Its IUPAC name is ethane;methyl 1-(4-methylphenyl)-1,2,4-triazole-3-carboxylate.
Molecular Properties
| Compound Name | ethane;methyl 1-(4-methylphenyl)-1,2,4-triazole-3-carboxylate |
| PubChem CID | 144636551 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | ethane;methyl 1-(4-methylphenyl)-1,2,4-triazole-3-carboxylate |
| SMILES | CC.COC(=O)c1ncn(-c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C11H11N3O2.C2H6/c1-8-3-5-9(6-4-8)14-7-12-10(13-14)11(15)16-2;1-2/h3-7H,1-2H3;1-2H3 |
| InChIKey | NMNDGWQTPNFWKJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethane;methyl 1-(4-methylphenyl)-1,2,4-triazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl 1-(4-methylphenyl)-1,2,4-triazole-3-carboxylate?
The IUPAC name of ethane;methyl 1-(4-methylphenyl)-1,2,4-triazole-3-carboxylate (CID 144636551) is ethane;methyl 1-(4-methylphenyl)-1,2,4-triazole-3-carboxylate.
What is the SMILES notation for ethane;methyl 1-(4-methylphenyl)-1,2,4-triazole-3-carboxylate?
The canonical SMILES for ethane;methyl 1-(4-methylphenyl)-1,2,4-triazole-3-carboxylate is CC.COC(=O)c1ncn(-c2ccc(C)cc2)n1.
What is the InChIKey of ethane;methyl 1-(4-methylphenyl)-1,2,4-triazole-3-carboxylate?
The InChIKey is NMNDGWQTPNFWKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O2.C2H6/c1-8-3-5-9(6-4-8)14-7-12-10(13-14)11(15)16-2;1-2/h3-7H,1-2H3;1-2H3.
What are the key properties of ethane;methyl 1-(4-methylphenyl)-1,2,4-triazole-3-carboxylate?
ethane;methyl 1-(4-methylphenyl)-1,2,4-triazole-3-carboxylate has a molecular weight of 247.30 g/mol, XLogP of 2.39, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl 1-(4-methylphenyl)-1,2,4-triazole-3-carboxylate is sourced from PubChem (CID 144636551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).