C13H14N4O — CID 42656771
1-(4-methylphenyl)-N-prop-2-enyl-1,2,4-triazole-3-carboxamide (PubChem CID 42656771) has the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. Its IUPAC name is 1-(4-methylphenyl)-N-prop-2-enyl-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-(4-methylphenyl)-N-prop-2-enyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 42656771 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 1-(4-methylphenyl)-N-prop-2-enyl-1,2,4-triazole-3-carboxamide |
| SMILES | C=CCNC(=O)c1ncn(-c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C13H14N4O/c1-3-8-14-13(18)12-15-9-17(16-12)11-6-4-10(2)5-7-11/h3-7,9H,1,8H2,2H3,(H,14,18) |
| InChIKey | CNERDVOZPCFLTM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|