About [4,5-bis(ethenyl)-2,3-dihydrofuran-2-yl]methanamine
[4,5-bis(ethenyl)-2,3-dihydrofuran-2-yl]methanamine (PubChem CID 144636646) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is [4,5-bis(ethenyl)-2,3-dihydrofuran-2-yl]methanamine.
Analyze [4,5-bis(ethenyl)-2,3-dihydrofuran-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,5-bis(ethenyl)-2,3-dihydrofuran-2-yl]methanamine?
The IUPAC name of [4,5-bis(ethenyl)-2,3-dihydrofuran-2-yl]methanamine (CID 144636646) is [4,5-bis(ethenyl)-2,3-dihydrofuran-2-yl]methanamine.
What is the SMILES notation for [4,5-bis(ethenyl)-2,3-dihydrofuran-2-yl]methanamine?
The canonical SMILES for [4,5-bis(ethenyl)-2,3-dihydrofuran-2-yl]methanamine is C=CC1=C(C=C)OC(CN)C1.
What is the InChIKey of [4,5-bis(ethenyl)-2,3-dihydrofuran-2-yl]methanamine?
The InChIKey is XFMYRFJHQRRWTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c1-3-7-5-8(6-10)11-9(7)4-2/h3-4,8H,1-2,5-6,10H2.
What are the key properties of [4,5-bis(ethenyl)-2,3-dihydrofuran-2-yl]methanamine?
[4,5-bis(ethenyl)-2,3-dihydrofuran-2-yl]methanamine has a molecular weight of 151.21 g/mol, XLogP of 1.36, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4,5-bis(ethenyl)-2,3-dihydrofuran-2-yl]methanamine is sourced from PubChem (CID 144636646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).