C9H10NOY- — CID 59106161
3,5-dihydro-2H-1-benzofuran-5-id-2-ylmethanamine;yttrium (PubChem CID 59106161) has the molecular formula C9H10NOY- and a molecular weight of 237.09 g/mol. Its IUPAC name is 3,5-dihydro-2H-1-benzofuran-5-id-2-ylmethanamine;yttrium.
| Compound Name | 3,5-dihydro-2H-1-benzofuran-5-id-2-ylmethanamine;yttrium |
|---|---|
| PubChem CID | 59106161 |
| Molecular Formula | C9H10NOY- |
| Molecular Weight | 237.09 g/mol |
| Exact Mass | 236.98 |
| IUPAC Name | 3,5-dihydro-2H-1-benzofuran-5-id-2-ylmethanamine;yttrium |
| SMILES | NCC1Cc2c[c-]ccc2O1.[Y] |
| InChI | InChI=1S/C9H10NO.Y/c10-6-8-5-7-3-1-2-4-9(7)11-8;/h2-4,8H,5-6,10H2;/q-1; |
| InChIKey | DOLDYPGGZBHXAN-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.09 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|