C10H12NOY- — CID 59106162
1-(3,5-dihydro-2H-1-benzofuran-5-id-2-yl)-N-methylmethanamine;yttrium (PubChem CID 59106162) has the molecular formula C10H12NOY- and a molecular weight of 251.12 g/mol. Its IUPAC name is 1-(3,5-dihydro-2H-1-benzofuran-5-id-2-yl)-N-methylmethanamine;yttrium.
| Compound Name | 1-(3,5-dihydro-2H-1-benzofuran-5-id-2-yl)-N-methylmethanamine;yttrium |
|---|---|
| PubChem CID | 59106162 |
| Molecular Formula | C10H12NOY- |
| Molecular Weight | 251.12 g/mol |
| Exact Mass | 251.00 |
| IUPAC Name | 1-(3,5-dihydro-2H-1-benzofuran-5-id-2-yl)-N-methylmethanamine;yttrium |
| SMILES | CNCC1Cc2c[c-]ccc2O1.[Y] |
| InChI | InChI=1S/C10H12NO.Y/c1-11-7-9-6-8-4-2-3-5-10(8)12-9;/h3-5,9,11H,6-7H2,1H3;/q-1; |
| InChIKey | HCRNHAMPSDNRLR-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.12 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|