C11H14NOY- — CID 58999611
(7-methyl-2,3,4,8-tetrahydrochromen-8-id-2-yl)methanamine;yttrium (PubChem CID 58999611) has the molecular formula C11H14NOY- and a molecular weight of 265.14 g/mol. Its IUPAC name is (7-methyl-2,3,4,8-tetrahydrochromen-8-id-2-yl)methanamine;yttrium.
| Compound Name | (7-methyl-2,3,4,8-tetrahydrochromen-8-id-2-yl)methanamine;yttrium |
|---|---|
| PubChem CID | 58999611 |
| Molecular Formula | C11H14NOY- |
| Molecular Weight | 265.14 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | (7-methyl-2,3,4,8-tetrahydrochromen-8-id-2-yl)methanamine;yttrium |
| SMILES | Cc1[c-]c2c(cc1)CCC(CN)O2.[Y] |
| InChI | InChI=1S/C11H14NO.Y/c1-8-2-3-9-4-5-10(7-12)13-11(9)6-8;/h2-3,10H,4-5,7,12H2,1H3;/q-1; |
| InChIKey | QCUCBWPSCKJRCE-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.14 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|