C32H34N4O4 — CID 144637350
3-formamido-4-[(E)-1-phenyl-1-[[2-(2-piperidin-1-ylacetyl)-1,3-dihydroisoindol-5-yl]amino]prop-1-en-2-yl]benzoic acid (PubChem CID 144637350) has the molecular formula C32H34N4O4 and a molecular weight of 538.65 g/mol. Its IUPAC name is 3-formamido-4-[(E)-1-phenyl-1-[[2-(2-piperidin-1-ylacetyl)-1,3-dihydroisoindol-5-yl]amino]prop-1-en-2-yl]benzoic acid.
| Compound Name | 3-formamido-4-[(E)-1-phenyl-1-[[2-(2-piperidin-1-ylacetyl)-1,3-dihydroisoindol-5-yl]amino]prop-1-en-2-yl]benzoic acid |
|---|---|
| PubChem CID | 144637350 |
| Molecular Formula | C32H34N4O4 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | 3-formamido-4-[(E)-1-phenyl-1-[[2-(2-piperidin-1-ylacetyl)-1,3-dihydroisoindol-5-yl]amino]prop-1-en-2-yl]benzoic acid |
| SMILES | C/C(=C(\Nc1ccc2c(c1)CN(C(=O)CN1CCCCC1)C2)c1ccccc1)c1ccc(C(=O)O)cc1NC=O |
| InChI | InChI=1S/C32H34N4O4/c1-22(28-13-11-24(32(39)40)17-29(28)33-21-37)31(23-8-4-2-5-9-23)34-27-12-10-25-18-36(19-26(25)16-27)30(38)20-35-14-6-3-7-15-35/h2,4-5,8-13,16-17,21,34H,3,6-7,14-15,18-20H2,1H3,(H,33,37)(H,39,40)/b31-22+ |
| InChIKey | AXHVCXSJCYPZBV-DFKUXCBWSA-N |
| XLogP | 5.28 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|