C35H40N4O4 — CID 90210176
propan-2-yl 3-methyl-4-[(Z)-1-[[1-[2-(4-methylpiperazin-1-yl)acetyl]-2,3-dihydroindol-5-yl]amino]-3-oxo-1-phenylprop-1-en-2-yl]benzoate (PubChem CID 90210176) has the molecular formula C35H40N4O4 and a molecular weight of 580.73 g/mol. Its IUPAC name is propan-2-yl 3-methyl-4-[(Z)-1-[[1-[2-(4-methylpiperazin-1-yl)acetyl]-2,3-dihydroindol-5-yl]amino]-3-oxo-1-phenylprop-1-en-2-yl]benzoate.
| Compound Name | propan-2-yl 3-methyl-4-[(Z)-1-[[1-[2-(4-methylpiperazin-1-yl)acetyl]-2,3-dihydroindol-5-yl]amino]-3-oxo-1-phenylprop-1-en-2-yl]benzoate |
|---|---|
| PubChem CID | 90210176 |
| Molecular Formula | C35H40N4O4 |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.30 |
| IUPAC Name | propan-2-yl 3-methyl-4-[(Z)-1-[[1-[2-(4-methylpiperazin-1-yl)acetyl]-2,3-dihydroindol-5-yl]amino]-3-oxo-1-phenylprop-1-en-2-yl]benzoate |
| SMILES | Cc1cc(C(=O)OC(C)C)ccc1/C(C=O)=C(/Nc1ccc2c(c1)CCN2C(=O)CN1CCN(C)CC1)c1ccccc1 |
| InChI | InChI=1S/C35H40N4O4/c1-24(2)43-35(42)28-10-12-30(25(3)20-28)31(23-40)34(26-8-6-5-7-9-26)36-29-11-13-32-27(21-29)14-15-39(32)33(41)22-38-18-16-37(4)17-19-38/h5-13,20-21,23-24,36H,14-19,22H2,1-4H3/b34-31+ |
| InChIKey | JVVRQTGLWHRIHC-WUVHBKSUSA-N |
| XLogP | 4.88 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|