C34H41N5O5 — CID 129307380
methyl 3-formamido-4-[(E)-1-[3-methyl-4-[methyl-[2-(4-methylpiperazin-1-yl)ethoxy]carbamoyl]anilino]-1-phenylprop-1-en-2-yl]benzoate (PubChem CID 129307380) has the molecular formula C34H41N5O5 and a molecular weight of 599.73 g/mol. Its IUPAC name is methyl 3-formamido-4-[(E)-1-[3-methyl-4-[methyl-[2-(4-methylpiperazin-1-yl)ethoxy]carbamoyl]anilino]-1-phenylprop-1-en-2-yl]benzoate.
| Compound Name | methyl 3-formamido-4-[(E)-1-[3-methyl-4-[methyl-[2-(4-methylpiperazin-1-yl)ethoxy]carbamoyl]anilino]-1-phenylprop-1-en-2-yl]benzoate |
|---|---|
| PubChem CID | 129307380 |
| Molecular Formula | C34H41N5O5 |
| Molecular Weight | 599.73 g/mol |
| Exact Mass | 599.31 |
| IUPAC Name | methyl 3-formamido-4-[(E)-1-[3-methyl-4-[methyl-[2-(4-methylpiperazin-1-yl)ethoxy]carbamoyl]anilino]-1-phenylprop-1-en-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(/C(C)=C(/Nc2ccc(C(=O)N(C)OCCN3CCN(C)CC3)c(C)c2)c2ccccc2)c(NC=O)c1 |
| InChI | InChI=1S/C34H41N5O5/c1-24-21-28(12-14-29(24)33(41)38(4)44-20-19-39-17-15-37(3)16-18-39)36-32(26-9-7-6-8-10-26)25(2)30-13-11-27(34(42)43-5)22-31(30)35-23-40/h6-14,21-23,36H,15-20H2,1-5H3,(H,35,40)/b32-25+ |
| InChIKey | NFSAXRLOYWJOHW-WGPBWIAQSA-N |
| XLogP | 4.60 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.73 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|