C37H55N5O4 — CID 144637380
ethane;methyl 3-methyl-4-[(Z)-1-[[1-[2-(4-methylpiperazin-1-yl)acetyl]-2,3,3a,4,5,6,7,7a-octahydropyrrolo[3,2-b]pyridin-5-yl]amino]-3-oxo-1-phenylbut-1-en-2-yl]benzoate (PubChem CID 144637380) has the molecular formula C37H55N5O4 and a molecular weight of 633.88 g/mol. Its IUPAC name is ethane;methyl 3-methyl-4-[(Z)-1-[[1-[2-(4-methylpiperazin-1-yl)acetyl]-2,3,3a,4,5,6,7,7a-octahydropyrrolo[3,2-b]pyridin-5-yl]amino]-3-oxo-1-phenylbut-1-en-2-yl]benzoate.
| Compound Name | ethane;methyl 3-methyl-4-[(Z)-1-[[1-[2-(4-methylpiperazin-1-yl)acetyl]-2,3,3a,4,5,6,7,7a-octahydropyrrolo[3,2-b]pyridin-5-yl]amino]-3-oxo-1-phenylbut-1-en-2-yl]benzoate |
|---|---|
| PubChem CID | 144637380 |
| Molecular Formula | C37H55N5O4 |
| Molecular Weight | 633.88 g/mol |
| Exact Mass | 633.43 |
| IUPAC Name | ethane;methyl 3-methyl-4-[(Z)-1-[[1-[2-(4-methylpiperazin-1-yl)acetyl]-2,3,3a,4,5,6,7,7a-octahydropyrrolo[3,2-b]pyridin-5-yl]amino]-3-oxo-1-phenylbut-1-en-2-yl]benzoate |
| SMILES | CC.CC.COC(=O)c1ccc(/C(C(C)=O)=C(/NC2CCC3C(CCN3C(=O)CN3CCN(C)CC3)N2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C33H43N5O4.2C2H6/c1-22-20-25(33(41)42-4)10-11-26(22)31(23(2)39)32(24-8-6-5-7-9-24)35-29-13-12-28-27(34-29)14-15-38(28)30(40)21-37-18-16-36(3)17-19-37;2*1-2/h5-11,20,27-29,34-35H,12-19,21H2,1-4H3;2*1-2H3/b32-31+;; |
| InChIKey | YGZRPVFEMQULCI-GLDAUVFXSA-N |
| XLogP | 4.81 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.88 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|