C35H31N3O5 — CID 90209627
methyl 4-[(Z)-1-[[1-(3-anilino-3-oxopropanoyl)-2,3-dihydroindol-5-yl]amino]-3-oxo-1-phenylprop-1-en-2-yl]-3-methylbenzoate (PubChem CID 90209627) has the molecular formula C35H31N3O5 and a molecular weight of 573.65 g/mol. Its IUPAC name is methyl 4-[(Z)-1-[[1-(3-anilino-3-oxopropanoyl)-2,3-dihydroindol-5-yl]amino]-3-oxo-1-phenylprop-1-en-2-yl]-3-methylbenzoate.
| Compound Name | methyl 4-[(Z)-1-[[1-(3-anilino-3-oxopropanoyl)-2,3-dihydroindol-5-yl]amino]-3-oxo-1-phenylprop-1-en-2-yl]-3-methylbenzoate |
|---|---|
| PubChem CID | 90209627 |
| Molecular Formula | C35H31N3O5 |
| Molecular Weight | 573.65 g/mol |
| Exact Mass | 573.23 |
| IUPAC Name | methyl 4-[(Z)-1-[[1-(3-anilino-3-oxopropanoyl)-2,3-dihydroindol-5-yl]amino]-3-oxo-1-phenylprop-1-en-2-yl]-3-methylbenzoate |
| SMILES | COC(=O)c1ccc(/C(C=O)=C(/Nc2ccc3c(c2)CCN3C(=O)CC(=O)Nc2ccccc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C35H31N3O5/c1-23-19-26(35(42)43-2)13-15-29(23)30(22-39)34(24-9-5-3-6-10-24)37-28-14-16-31-25(20-28)17-18-38(31)33(41)21-32(40)36-27-11-7-4-8-12-27/h3-16,19-20,22,37H,17-18,21H2,1-2H3,(H,36,40)/b34-30+ |
| InChIKey | UAKNUSHLJKTZLK-VBMGMRCRSA-N |
| XLogP | 5.88 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.65 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|