C16H18Cl2NO3+ — CID 144638569
1-(3,5-dichloropyridin-1-ium-4-yl)-2-(3,4-dimethoxyphenyl)propan-2-ol (PubChem CID 144638569) has the molecular formula C16H18Cl2NO3+ and a molecular weight of 343.23 g/mol. Its IUPAC name is 1-(3,5-dichloropyridin-1-ium-4-yl)-2-(3,4-dimethoxyphenyl)propan-2-ol.
| Compound Name | 1-(3,5-dichloropyridin-1-ium-4-yl)-2-(3,4-dimethoxyphenyl)propan-2-ol |
|---|---|
| PubChem CID | 144638569 |
| Molecular Formula | C16H18Cl2NO3+ |
| Molecular Weight | 343.23 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 1-(3,5-dichloropyridin-1-ium-4-yl)-2-(3,4-dimethoxyphenyl)propan-2-ol |
| SMILES | COc1ccc(C(C)(O)Cc2c(Cl)c[nH+]cc2Cl)cc1OC |
| InChI | InChI=1S/C16H17Cl2NO3/c1-16(20,7-11-12(17)8-19-9-13(11)18)10-4-5-14(21-2)15(6-10)22-3/h4-6,8-9,20H,7H2,1-3H3/p+1 |
| InChIKey | TYFIFFZATKHBKU-UHFFFAOYSA-O |
| XLogP | 3.27 |
| TPSA | 52.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.23 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |