About ethane;2-methyl-N'-[(Z)-prop-1-enyl]but-3-enimidamide;molecular hydrogen
ethane;2-methyl-N'-[(Z)-prop-1-enyl]but-3-enimidamide;molecular hydrogen (PubChem CID 144647200) has the molecular formula C10H22N2
and a molecular weight of 170.30 g/mol. Its IUPAC name is ethane;2-methyl-N'-[(Z)-prop-1-enyl]but-3-enimidamide;molecular hydrogen.
Molecular Properties
| Compound Name | ethane;2-methyl-N'-[(Z)-prop-1-enyl]but-3-enimidamide;molecular hydrogen |
| PubChem CID | 144647200 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | ethane;2-methyl-N'-[(Z)-prop-1-enyl]but-3-enimidamide;molecular hydrogen |
| SMILES | C=CC(C)/C(N)=N/C=C\C.CC.[H][H] |
| InChI | InChI=1S/C8H14N2.C2H6.H2/c1-4-6-10-8(9)7(3)5-2;1-2;/h4-7H,2H2,1,3H3,(H2,9,10);1-2H3;1H/b6-4-;; |
| InChIKey | VHQLAYQYPXQRFP-XFUGJFOESA-N |
| XLogP | 2.97 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methyl-N'-[(Z)-prop-1-enyl]but-3-enimidamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyl-N'-[(Z)-prop-1-enyl]but-3-enimidamide;molecular hydrogen?
The IUPAC name of ethane;2-methyl-N'-[(Z)-prop-1-enyl]but-3-enimidamide;molecular hydrogen (CID 144647200) is ethane;2-methyl-N'-[(Z)-prop-1-enyl]but-3-enimidamide;molecular hydrogen.
What is the SMILES notation for ethane;2-methyl-N'-[(Z)-prop-1-enyl]but-3-enimidamide;molecular hydrogen?
The canonical SMILES for ethane;2-methyl-N'-[(Z)-prop-1-enyl]but-3-enimidamide;molecular hydrogen is C=CC(C)/C(N)=N/C=C\C.CC.[H][H].
What is the InChIKey of ethane;2-methyl-N'-[(Z)-prop-1-enyl]but-3-enimidamide;molecular hydrogen?
The InChIKey is VHQLAYQYPXQRFP-XFUGJFOESA-N. The full InChI is InChI=1S/C8H14N2.C2H6.H2/c1-4-6-10-8(9)7(3)5-2;1-2;/h4-7H,2H2,1,3H3,(H2,9,10);1-2H3;1H/b6-4-;;.
What are the key properties of ethane;2-methyl-N'-[(Z)-prop-1-enyl]but-3-enimidamide;molecular hydrogen?
ethane;2-methyl-N'-[(Z)-prop-1-enyl]but-3-enimidamide;molecular hydrogen has a molecular weight of 170.30 g/mol, XLogP of 2.97, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyl-N'-[(Z)-prop-1-enyl]but-3-enimidamide;molecular hydrogen is sourced from PubChem (CID 144647200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).