C26H30ClFN2OS — CID 144650774
2-amino-N-[[3-[2-(4-chlorophenyl)ethyl]phenyl]methyl]pentanamide;4-fluorobenzenethiol (PubChem CID 144650774) has the molecular formula C26H30ClFN2OS and a molecular weight of 473.06 g/mol. Its IUPAC name is 2-amino-N-[[3-[2-(4-chlorophenyl)ethyl]phenyl]methyl]pentanamide;4-fluorobenzenethiol.
| Compound Name | 2-amino-N-[[3-[2-(4-chlorophenyl)ethyl]phenyl]methyl]pentanamide;4-fluorobenzenethiol |
|---|---|
| PubChem CID | 144650774 |
| Molecular Formula | C26H30ClFN2OS |
| Molecular Weight | 473.06 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 2-amino-N-[[3-[2-(4-chlorophenyl)ethyl]phenyl]methyl]pentanamide;4-fluorobenzenethiol |
| SMILES | CCCC(N)C(=O)NCc1cccc(CCc2ccc(Cl)cc2)c1.Fc1ccc(S)cc1 |
| InChI | InChI=1S/C20H25ClN2O.C6H5FS/c1-2-4-19(22)20(24)23-14-17-6-3-5-16(13-17)8-7-15-9-11-18(21)12-10-15;7-5-1-3-6(8)4-2-5/h3,5-6,9-13,19H,2,4,7-8,14,22H2,1H3,(H,23,24);1-4,8H |
| InChIKey | VMQNSPOSKWFSAJ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.06 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|