C19H16F2N2O3S — CID 144651359
5-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-2-(1-ethoxyethenyl)-3-methylpyran-4-one (PubChem CID 144651359) has the molecular formula C19H16F2N2O3S and a molecular weight of 390.41 g/mol. Its IUPAC name is 5-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-2-(1-ethoxyethenyl)-3-methylpyran-4-one.
| Compound Name | 5-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-2-(1-ethoxyethenyl)-3-methylpyran-4-one |
|---|---|
| PubChem CID | 144651359 |
| Molecular Formula | C19H16F2N2O3S |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 5-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-2-(1-ethoxyethenyl)-3-methylpyran-4-one |
| SMILES | C=C(OCC)c1occ(-c2nnc(Cc3ccc(F)cc3F)s2)c(=O)c1C |
| InChI | InChI=1S/C19H16F2N2O3S/c1-4-25-11(3)18-10(2)17(24)14(9-26-18)19-23-22-16(27-19)7-12-5-6-13(20)8-15(12)21/h5-6,8-9H,3-4,7H2,1-2H3 |
| InChIKey | ZMHSPNBRZDDEKM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|