C21H21F2N5O3S — CID 155442133
7-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-3-(2-methoxyethyl)-2,9-dimethyl-4H-pyrido[1,2-d][1,2,4]triazine-1,8-dione (PubChem CID 155442133) has the molecular formula C21H21F2N5O3S and a molecular weight of 461.49 g/mol. Its IUPAC name is 7-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-3-(2-methoxyethyl)-2,9-dimethyl-4H-pyrido[1,2-d][1,2,4]triazine-1,8-dione.
| Compound Name | 7-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-3-(2-methoxyethyl)-2,9-dimethyl-4H-pyrido[1,2-d][1,2,4]triazine-1,8-dione |
|---|---|
| PubChem CID | 155442133 |
| Molecular Formula | C21H21F2N5O3S |
| Molecular Weight | 461.49 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | 7-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-3-(2-methoxyethyl)-2,9-dimethyl-4H-pyrido[1,2-d][1,2,4]triazine-1,8-dione |
| SMILES | COCCN1Cn2cc(-c3nnc(Cc4ccc(F)cc4F)s3)c(=O)c(C)c2C(=O)N1C |
| InChI | InChI=1S/C21H21F2N5O3S/c1-12-18-21(30)26(2)28(6-7-31-3)11-27(18)10-15(19(12)29)20-25-24-17(32-20)8-13-4-5-14(22)9-16(13)23/h4-5,9-10H,6-8,11H2,1-3H3 |
| InChIKey | YLMMURKIXKOQDN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.49 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |