About ethane;methoxyethane;2-methylpropane
ethane;methoxyethane;2-methylpropane (PubChem CID 144654475) has the molecular formula C9H24O
and a molecular weight of 148.29 g/mol. Its IUPAC name is ethane;methoxyethane;2-methylpropane.
Molecular Properties
| Compound Name | ethane;methoxyethane;2-methylpropane |
| PubChem CID | 144654475 |
| Molecular Formula | C9H24O |
| Molecular Weight | 148.29 g/mol |
| Exact Mass | 148.18 |
| IUPAC Name | ethane;methoxyethane;2-methylpropane |
| SMILES | CC.CC(C)C.CCOC |
| InChI | InChI=1S/C4H10.C3H8O.C2H6/c1-4(2)3;1-3-4-2;1-2/h4H,1-3H3;3H2,1-2H3;1-2H3 |
| InChIKey | IJOBGLJXHAICRD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.29 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;methoxyethane;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methoxyethane;2-methylpropane?
The IUPAC name of ethane;methoxyethane;2-methylpropane (CID 144654475) is ethane;methoxyethane;2-methylpropane.
What is the SMILES notation for ethane;methoxyethane;2-methylpropane?
The canonical SMILES for ethane;methoxyethane;2-methylpropane is CC.CC(C)C.CCOC.
What is the InChIKey of ethane;methoxyethane;2-methylpropane?
The InChIKey is IJOBGLJXHAICRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10.C3H8O.C2H6/c1-4(2)3;1-3-4-2;1-2/h4H,1-3H3;3H2,1-2H3;1-2H3.
What are the key properties of ethane;methoxyethane;2-methylpropane?
ethane;methoxyethane;2-methylpropane has a molecular weight of 148.29 g/mol, XLogP of 3.34, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methoxyethane;2-methylpropane is sourced from PubChem (CID 144654475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).