C17H29N3O — CID 144655303
1-[4-[(4-ethyl-2-pyridinyl)amino]piperidin-1-yl]-3-methylbutan-1-one;molecular hydrogen (PubChem CID 144655303) has the molecular formula C17H29N3O and a molecular weight of 291.44 g/mol. Its IUPAC name is 1-[4-[(4-ethyl-2-pyridinyl)amino]piperidin-1-yl]-3-methylbutan-1-one;molecular hydrogen.
| Compound Name | 1-[4-[(4-ethyl-2-pyridinyl)amino]piperidin-1-yl]-3-methylbutan-1-one;molecular hydrogen |
|---|---|
| PubChem CID | 144655303 |
| Molecular Formula | C17H29N3O |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.23 |
| IUPAC Name | 1-[4-[(4-ethyl-2-pyridinyl)amino]piperidin-1-yl]-3-methylbutan-1-one;molecular hydrogen |
| SMILES | CCc1ccnc(NC2CCN(C(=O)CC(C)C)CC2)c1.[H][H] |
| InChI | InChI=1S/C17H27N3O.H2/c1-4-14-5-8-18-16(12-14)19-15-6-9-20(10-7-15)17(21)11-13(2)3;/h5,8,12-13,15H,4,6-7,9-11H2,1-3H3,(H,18,19);1H |
| InChIKey | ZZFLCWDYRWBWKO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |