C22H34O4 — CID 14465599
[2-oxo-5-(1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl)oxan-4-yl]methyl acetate (PubChem CID 14465599) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is [2-oxo-5-(1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl)oxan-4-yl]methyl acetate.
| Compound Name | [2-oxo-5-(1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl)oxan-4-yl]methyl acetate |
|---|---|
| PubChem CID | 14465599 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | [2-oxo-5-(1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl)oxan-4-yl]methyl acetate |
| SMILES | C=C1CCCC(C)(C)C2CCC(C)(C3COC(=O)CC3COC(C)=O)C12 |
| InChI | InChI=1S/C22H34O4/c1-14-7-6-9-21(3,4)17-8-10-22(5,20(14)17)18-13-26-19(24)11-16(18)12-25-15(2)23/h16-18,20H,1,6-13H2,2-5H3 |
| InChIKey | BEESRRLXQIVBCJ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|