C20H32O3 — CID 53235905
[(1R,3aR,4R,7S,8aS)-1,4-dimethyl-8-oxo-7-prop-1-en-2-yl-1,2,3,3a,5,6,7,8a-octahydroazulen-4-yl] 2,2-dimethylpropanoate (PubChem CID 53235905) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is [(1R,3aR,4R,7S,8aS)-1,4-dimethyl-8-oxo-7-prop-1-en-2-yl-1,2,3,3a,5,6,7,8a-octahydroazulen-4-yl] 2,2-dimethylpropanoate.
| Compound Name | [(1R,3aR,4R,7S,8aS)-1,4-dimethyl-8-oxo-7-prop-1-en-2-yl-1,2,3,3a,5,6,7,8a-octahydroazulen-4-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 53235905 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | [(1R,3aR,4R,7S,8aS)-1,4-dimethyl-8-oxo-7-prop-1-en-2-yl-1,2,3,3a,5,6,7,8a-octahydroazulen-4-yl] 2,2-dimethylpropanoate |
| SMILES | C=C(C)[C@@H]1CC[C@@](C)(OC(=O)C(C)(C)C)[C@@H]2CC[C@@H](C)[C@@H]2C1=O |
| InChI | InChI=1S/C20H32O3/c1-12(2)14-10-11-20(7,23-18(22)19(4,5)6)15-9-8-13(3)16(15)17(14)21/h13-16H,1,8-11H2,2-7H3/t13-,14+,15-,16+,20-/m1/s1 |
| InChIKey | YVXCPQLJAMGCEZ-HWEQFAERSA-N |
| XLogP | 4.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|