C20H28O3 — CID 14465605
3-(1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl)-4,6a-dihydro-3aH-furo[2,3-b]furan-5-one (PubChem CID 14465605) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is 3-(1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl)-4,6a-dihydro-3aH-furo[2,3-b]furan-5-one.
| Compound Name | 3-(1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl)-4,6a-dihydro-3aH-furo[2,3-b]furan-5-one |
|---|---|
| PubChem CID | 14465605 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 3-(1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl)-4,6a-dihydro-3aH-furo[2,3-b]furan-5-one |
| SMILES | C=C1CCCC(C)(C)C2CCC(C)(C3=COC4OC(=O)CC34)C12 |
| InChI | InChI=1S/C20H28O3/c1-12-6-5-8-19(2,3)14-7-9-20(4,17(12)14)15-11-22-18-13(15)10-16(21)23-18/h11,13-14,17-18H,1,5-10H2,2-4H3 |
| InChIKey | PZPRJMGTPJGZHN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|