C22H32O5 — CID 14465603
[5-oxo-3-(1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl)-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-2-yl] acetate (PubChem CID 14465603) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is [5-oxo-3-(1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl)-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-2-yl] acetate.
| Compound Name | [5-oxo-3-(1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl)-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-2-yl] acetate |
|---|---|
| PubChem CID | 14465603 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | [5-oxo-3-(1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl)-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-2-yl] acetate |
| SMILES | C=C1CCCC(C)(C)C2CCC(C)(C3C(OC(C)=O)OC4OC(=O)CC43)C12 |
| InChI | InChI=1S/C22H32O5/c1-12-7-6-9-21(3,4)15-8-10-22(5,17(12)15)18-14-11-16(24)26-19(14)27-20(18)25-13(2)23/h14-15,17-20H,1,6-11H2,2-5H3 |
| InChIKey | LGCPEYXXNIOSTF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|