C16H29FN2 — CID 144656759
ethane;2-ethyl-4-[(3E,5E)-6-fluorohepta-1,3,5-trien-3-yl]-1-methylpiperazine (PubChem CID 144656759) has the molecular formula C16H29FN2 and a molecular weight of 268.42 g/mol. Its IUPAC name is ethane;2-ethyl-4-[(3E,5E)-6-fluorohepta-1,3,5-trien-3-yl]-1-methylpiperazine.
| Compound Name | ethane;2-ethyl-4-[(3E,5E)-6-fluorohepta-1,3,5-trien-3-yl]-1-methylpiperazine |
|---|---|
| PubChem CID | 144656759 |
| Molecular Formula | C16H29FN2 |
| Molecular Weight | 268.42 g/mol |
| Exact Mass | 268.23 |
| IUPAC Name | ethane;2-ethyl-4-[(3E,5E)-6-fluorohepta-1,3,5-trien-3-yl]-1-methylpiperazine |
| SMILES | C=C/C(=C\C=C(/C)F)N1CCN(C)C(CC)C1.CC |
| InChI | InChI=1S/C14H23FN2.C2H6/c1-5-13(8-7-12(3)15)17-10-9-16(4)14(6-2)11-17;1-2/h5,7-8,14H,1,6,9-11H2,2-4H3;1-2H3/b12-7+,13-8+; |
| InChIKey | AVPKJQVPLWCZSA-PBBYLEHCSA-N |
| XLogP | 3.98 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|