C7H15NS — CID 144657521
4,5-dimethyl-2,3-dihydro-1,3-thiazole;ethane (PubChem CID 144657521) has the molecular formula C7H15NS and a molecular weight of 145.27 g/mol. Its IUPAC name is 4,5-dimethyl-2,3-dihydro-1,3-thiazole;ethane.
| Compound Name | 4,5-dimethyl-2,3-dihydro-1,3-thiazole;ethane |
|---|---|
| PubChem CID | 144657521 |
| Molecular Formula | C7H15NS |
| Molecular Weight | 145.27 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 4,5-dimethyl-2,3-dihydro-1,3-thiazole;ethane |
| SMILES | CC.CC1=C(C)SCN1 |
| InChI | InChI=1S/C5H9NS.C2H6/c1-4-5(2)7-3-6-4;1-2/h6H,3H2,1-2H3;1-2H3 |
| InChIKey | BPDQKJDAPQCDMM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |