C18H21N — CID 144661992
(1Z,3E)-5-(6-methylcyclohexa-1,5-dien-1-yl)-3-phenylpenta-1,3-dien-1-amine (PubChem CID 144661992) has the molecular formula C18H21N and a molecular weight of 251.37 g/mol. Its IUPAC name is (1Z,3E)-5-(6-methylcyclohexa-1,5-dien-1-yl)-3-phenylpenta-1,3-dien-1-amine.
| Compound Name | (1Z,3E)-5-(6-methylcyclohexa-1,5-dien-1-yl)-3-phenylpenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 144661992 |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | (1Z,3E)-5-(6-methylcyclohexa-1,5-dien-1-yl)-3-phenylpenta-1,3-dien-1-amine |
| SMILES | CC1=CCCC=C1C/C=C(\C=C/N)c1ccccc1 |
| InChI | InChI=1S/C18H21N/c1-15-7-5-6-8-16(15)11-12-18(13-14-19)17-9-3-2-4-10-17/h2-4,7-10,12-14H,5-6,11,19H2,1H3/b14-13-,18-12+ |
| InChIKey | URVCVSSBDMKHOO-NTMPRHFZSA-N |
| XLogP | 4.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|