About (3E,5Z)-6-amino-2-methylidene-4-phenylhexa-3,5-dienal
(3E,5Z)-6-amino-2-methylidene-4-phenylhexa-3,5-dienal (PubChem CID 89294053) has the molecular formula C13H13NO
and a molecular weight of 199.25 g/mol. Its IUPAC name is (3E,5Z)-6-amino-2-methylidene-4-phenylhexa-3,5-dienal.
Molecular Properties
| Compound Name | (3E,5Z)-6-amino-2-methylidene-4-phenylhexa-3,5-dienal |
| PubChem CID | 89294053 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | (3E,5Z)-6-amino-2-methylidene-4-phenylhexa-3,5-dienal |
| SMILES | C=C(C=O)/C=C(\C=C/N)c1ccccc1 |
| InChI | InChI=1S/C13H13NO/c1-11(10-15)9-13(7-8-14)12-5-3-2-4-6-12/h2-10H,1,14H2/b8-7-,13-9+ |
| InChIKey | JMNKZVANEZYOIR-XTYDYKDCSA-N |
| XLogP | 2.30 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E,5Z)-6-amino-2-methylidene-4-phenylhexa-3,5-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,5Z)-6-amino-2-methylidene-4-phenylhexa-3,5-dienal?
The IUPAC name of (3E,5Z)-6-amino-2-methylidene-4-phenylhexa-3,5-dienal (CID 89294053) is (3E,5Z)-6-amino-2-methylidene-4-phenylhexa-3,5-dienal.
What is the SMILES notation for (3E,5Z)-6-amino-2-methylidene-4-phenylhexa-3,5-dienal?
The canonical SMILES for (3E,5Z)-6-amino-2-methylidene-4-phenylhexa-3,5-dienal is C=C(C=O)/C=C(\C=C/N)c1ccccc1.
What is the InChIKey of (3E,5Z)-6-amino-2-methylidene-4-phenylhexa-3,5-dienal?
The InChIKey is JMNKZVANEZYOIR-XTYDYKDCSA-N. The full InChI is InChI=1S/C13H13NO/c1-11(10-15)9-13(7-8-14)12-5-3-2-4-6-12/h2-10H,1,14H2/b8-7-,13-9+.
What are the key properties of (3E,5Z)-6-amino-2-methylidene-4-phenylhexa-3,5-dienal?
(3E,5Z)-6-amino-2-methylidene-4-phenylhexa-3,5-dienal has a molecular weight of 199.25 g/mol, XLogP of 2.30, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,5Z)-6-amino-2-methylidene-4-phenylhexa-3,5-dienal is sourced from PubChem (CID 89294053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).