C14H20O2 — CID 144662143
3,5-dimethyl-4-[2-methyl-1-(oxiran-2-yl)propan-2-yl]phenol (PubChem CID 144662143) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is 3,5-dimethyl-4-[2-methyl-1-(oxiran-2-yl)propan-2-yl]phenol.
| Compound Name | 3,5-dimethyl-4-[2-methyl-1-(oxiran-2-yl)propan-2-yl]phenol |
|---|---|
| PubChem CID | 144662143 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 3,5-dimethyl-4-[2-methyl-1-(oxiran-2-yl)propan-2-yl]phenol |
| SMILES | Cc1cc(O)cc(C)c1C(C)(C)CC1CO1 |
| InChI | InChI=1S/C14H20O2/c1-9-5-11(15)6-10(2)13(9)14(3,4)7-12-8-16-12/h5-6,12,15H,7-8H2,1-4H3 |
| InChIKey | XJFSBGRHSZELQE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|