C11H21IN2 — CID 144662709
4-methyl-2,6-di(propan-2-yl)-4,5-dihydropyrimidine;hydroiodide (PubChem CID 144662709) has the molecular formula C11H21IN2 and a molecular weight of 308.21 g/mol. Its IUPAC name is 4-methyl-2,6-di(propan-2-yl)-4,5-dihydropyrimidine;hydroiodide.
| Compound Name | 4-methyl-2,6-di(propan-2-yl)-4,5-dihydropyrimidine;hydroiodide |
|---|---|
| PubChem CID | 144662709 |
| Molecular Formula | C11H21IN2 |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 4-methyl-2,6-di(propan-2-yl)-4,5-dihydropyrimidine;hydroiodide |
| SMILES | CC1CC(C(C)C)=NC(C(C)C)=N1.I |
| InChI | InChI=1S/C11H20N2.HI/c1-7(2)10-6-9(5)12-11(13-10)8(3)4;/h7-9H,6H2,1-5H3;1H |
| InChIKey | SSJJKOKPNRXTFZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|