C16H30N4O2 — CID 144663994
3-[[(Z)-6-amino-5-(propylamino)hex-5-enyl]-methoxyamino]-6-methylidenepiperidin-2-one (PubChem CID 144663994) has the molecular formula C16H30N4O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 3-[[(Z)-6-amino-5-(propylamino)hex-5-enyl]-methoxyamino]-6-methylidenepiperidin-2-one.
| Compound Name | 3-[[(Z)-6-amino-5-(propylamino)hex-5-enyl]-methoxyamino]-6-methylidenepiperidin-2-one |
|---|---|
| PubChem CID | 144663994 |
| Molecular Formula | C16H30N4O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | 3-[[(Z)-6-amino-5-(propylamino)hex-5-enyl]-methoxyamino]-6-methylidenepiperidin-2-one |
| SMILES | C=C1CCC(N(CCCC/C(=C/N)NCCC)OC)C(=O)N1 |
| InChI | InChI=1S/C16H30N4O2/c1-4-10-18-14(12-17)7-5-6-11-20(22-3)15-9-8-13(2)19-16(15)21/h12,15,18H,2,4-11,17H2,1,3H3,(H,19,21)/b14-12- |
| InChIKey | JXIQPRREZFMXAI-OWBHPGMISA-N |
| XLogP | 1.61 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|