C10H16N2O2 — CID 158386766
2-methyl-N-(6-methylidene-2-oxopiperidin-3-yl)propanamide (PubChem CID 158386766) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 2-methyl-N-(6-methylidene-2-oxopiperidin-3-yl)propanamide.
| Compound Name | 2-methyl-N-(6-methylidene-2-oxopiperidin-3-yl)propanamide |
|---|---|
| PubChem CID | 158386766 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 2-methyl-N-(6-methylidene-2-oxopiperidin-3-yl)propanamide |
| SMILES | C=C1CCC(NC(=O)C(C)C)C(=O)N1 |
| InChI | InChI=1S/C10H16N2O2/c1-6(2)9(13)12-8-5-4-7(3)11-10(8)14/h6,8H,3-5H2,1-2H3,(H,11,14)(H,12,13) |
| InChIKey | SYXCLNSGDSQVTQ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |