C13H21N3O3 — CID 176669671
5-acetamido-N-(6-methylidene-2-oxopiperidin-3-yl)pentanamide (PubChem CID 176669671) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is 5-acetamido-N-(6-methylidene-2-oxopiperidin-3-yl)pentanamide.
| Compound Name | 5-acetamido-N-(6-methylidene-2-oxopiperidin-3-yl)pentanamide |
|---|---|
| PubChem CID | 176669671 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 5-acetamido-N-(6-methylidene-2-oxopiperidin-3-yl)pentanamide |
| SMILES | C=C1CCC(NC(=O)CCCCNC(C)=O)C(=O)N1 |
| InChI | InChI=1S/C13H21N3O3/c1-9-6-7-11(13(19)15-9)16-12(18)5-3-4-8-14-10(2)17/h11H,1,3-8H2,2H3,(H,14,17)(H,15,19)(H,16,18) |
| InChIKey | GYPOINLWDMATJG-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|