C18H23FN4O3 — CID 144668009
2-fluoro-5-[2-[2-(2-hydroxyethoxy)ethylamino]-4-propan-2-ylpyrimidin-5-yl]benzamide (PubChem CID 144668009) has the molecular formula C18H23FN4O3 and a molecular weight of 362.41 g/mol. Its IUPAC name is 2-fluoro-5-[2-[2-(2-hydroxyethoxy)ethylamino]-4-propan-2-ylpyrimidin-5-yl]benzamide.
| Compound Name | 2-fluoro-5-[2-[2-(2-hydroxyethoxy)ethylamino]-4-propan-2-ylpyrimidin-5-yl]benzamide |
|---|---|
| PubChem CID | 144668009 |
| Molecular Formula | C18H23FN4O3 |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 2-fluoro-5-[2-[2-(2-hydroxyethoxy)ethylamino]-4-propan-2-ylpyrimidin-5-yl]benzamide |
| SMILES | CC(C)c1nc(NCCOCCO)ncc1-c1ccc(F)c(C(N)=O)c1 |
| InChI | InChI=1S/C18H23FN4O3/c1-11(2)16-14(12-3-4-15(19)13(9-12)17(20)25)10-22-18(23-16)21-5-7-26-8-6-24/h3-4,9-11,24H,5-8H2,1-2H3,(H2,20,25)(H,21,22,23) |
| InChIKey | ZRGVSNXOLRIESA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|