C23H19F3N2O3 — CID 144668083
[6-[2-(3,5-difluorophenyl)-1-(methylamino)ethyl]-5-(4-fluoro-3-formylphenyl)-2-pyridinyl] acetate (PubChem CID 144668083) has the molecular formula C23H19F3N2O3 and a molecular weight of 428.41 g/mol. Its IUPAC name is [6-[2-(3,5-difluorophenyl)-1-(methylamino)ethyl]-5-(4-fluoro-3-formylphenyl)-2-pyridinyl] acetate.
| Compound Name | [6-[2-(3,5-difluorophenyl)-1-(methylamino)ethyl]-5-(4-fluoro-3-formylphenyl)-2-pyridinyl] acetate |
|---|---|
| PubChem CID | 144668083 |
| Molecular Formula | C23H19F3N2O3 |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | [6-[2-(3,5-difluorophenyl)-1-(methylamino)ethyl]-5-(4-fluoro-3-formylphenyl)-2-pyridinyl] acetate |
| SMILES | CNC(Cc1cc(F)cc(F)c1)c1nc(OC(C)=O)ccc1-c1ccc(F)c(C=O)c1 |
| InChI | InChI=1S/C23H19F3N2O3/c1-13(30)31-22-6-4-19(15-3-5-20(26)16(10-15)12-29)23(28-22)21(27-2)9-14-7-17(24)11-18(25)8-14/h3-8,10-12,21,27H,9H2,1-2H3 |
| InChIKey | QYXNONMZPYRRML-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|