C20H16F2N4O2 — CID 144505376
4-[2-[2-(3,5-difluorophenyl)-1-formamidoethyl]-3-pyridinyl]pyridine-2-carboxamide (PubChem CID 144505376) has the molecular formula C20H16F2N4O2 and a molecular weight of 382.37 g/mol. Its IUPAC name is 4-[2-[2-(3,5-difluorophenyl)-1-formamidoethyl]-3-pyridinyl]pyridine-2-carboxamide.
| Compound Name | 4-[2-[2-(3,5-difluorophenyl)-1-formamidoethyl]-3-pyridinyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 144505376 |
| Molecular Formula | C20H16F2N4O2 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 4-[2-[2-(3,5-difluorophenyl)-1-formamidoethyl]-3-pyridinyl]pyridine-2-carboxamide |
| SMILES | NC(=O)c1cc(-c2cccnc2C(Cc2cc(F)cc(F)c2)NC=O)ccn1 |
| InChI | InChI=1S/C20H16F2N4O2/c21-14-6-12(7-15(22)10-14)8-17(26-11-27)19-16(2-1-4-25-19)13-3-5-24-18(9-13)20(23)28/h1-7,9-11,17H,8H2,(H2,23,28)(H,26,27) |
| InChIKey | TYLYDXRMWSQVOW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|