C32H29F5N5O2P — CID 144505640
3-ethyl-5-(trifluoromethyl)-1H-indole;N-[1-[3-[4-fluoro-3-(hydrazinecarbonyl)phenyl]-2-pyridinyl]-2-(3-fluoro-5-phosphanylphenyl)ethyl]formamide (PubChem CID 144505640) has the molecular formula C32H29F5N5O2P and a molecular weight of 641.58 g/mol. Its IUPAC name is 3-ethyl-5-(trifluoromethyl)-1H-indole;N-[1-[3-[4-fluoro-3-(hydrazinecarbonyl)phenyl]-2-pyridinyl]-2-(3-fluoro-5-phosphanylphenyl)ethyl]formamide.
| Compound Name | 3-ethyl-5-(trifluoromethyl)-1H-indole;N-[1-[3-[4-fluoro-3-(hydrazinecarbonyl)phenyl]-2-pyridinyl]-2-(3-fluoro-5-phosphanylphenyl)ethyl]formamide |
|---|---|
| PubChem CID | 144505640 |
| Molecular Formula | C32H29F5N5O2P |
| Molecular Weight | 641.58 g/mol |
| Exact Mass | 641.20 |
| IUPAC Name | 3-ethyl-5-(trifluoromethyl)-1H-indole;N-[1-[3-[4-fluoro-3-(hydrazinecarbonyl)phenyl]-2-pyridinyl]-2-(3-fluoro-5-phosphanylphenyl)ethyl]formamide |
| SMILES | CCc1c[nH]c2ccc(C(F)(F)F)cc12.NNC(=O)c1cc(-c2cccnc2C(Cc2cc(F)cc(P)c2)NC=O)ccc1F |
| InChI | InChI=1S/C21H19F2N4O2P.C11H10F3N/c22-14-6-12(7-15(30)10-14)8-19(26-11-28)20-16(2-1-5-25-20)13-3-4-18(23)17(9-13)21(29)27-24;1-2-7-6-15-10-4-3-8(5-9(7)10)11(12,13)14/h1-7,9-11,19H,8,24,30H2,(H,26,28)(H,27,29);3-6,15H,2H2,1H3 |
| InChIKey | OMECFGSEPFTVNJ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.58 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|