C31H26F6N6O3 — CID 144505971
N-[2-(3,5-difluorophenyl)-1-[3-[4-fluoro-3-(hydrazinecarbonyl)phenyl]-2-pyridinyl]ethyl]formamide;7-ethyl-9-(trifluoromethyl)-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-5-one (PubChem CID 144505971) has the molecular formula C31H26F6N6O3 and a molecular weight of 644.58 g/mol. Its IUPAC name is N-[2-(3,5-difluorophenyl)-1-[3-[4-fluoro-3-(hydrazinecarbonyl)phenyl]-2-pyridinyl]ethyl]formamide;7-ethyl-9-(trifluoromethyl)-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-5-one.
| Compound Name | N-[2-(3,5-difluorophenyl)-1-[3-[4-fluoro-3-(hydrazinecarbonyl)phenyl]-2-pyridinyl]ethyl]formamide;7-ethyl-9-(trifluoromethyl)-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-5-one |
|---|---|
| PubChem CID | 144505971 |
| Molecular Formula | C31H26F6N6O3 |
| Molecular Weight | 644.58 g/mol |
| Exact Mass | 644.20 |
| IUPAC Name | N-[2-(3,5-difluorophenyl)-1-[3-[4-fluoro-3-(hydrazinecarbonyl)phenyl]-2-pyridinyl]ethyl]formamide;7-ethyl-9-(trifluoromethyl)-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-5-one |
| SMILES | CCn1nc(C(F)(F)F)c2c1C(=O)C1CC21.NNC(=O)c1cc(-c2cccnc2C(Cc2cc(F)cc(F)c2)NC=O)ccc1F |
| InChI | InChI=1S/C21H17F3N4O2.C10H9F3N2O/c22-14-6-12(7-15(23)10-14)8-19(27-11-29)20-16(2-1-5-26-20)13-3-4-18(24)17(9-13)21(30)28-25;1-2-15-7-6(4-3-5(4)8(7)16)9(14-15)10(11,12)13/h1-7,9-11,19H,8,25H2,(H,27,29)(H,28,30);4-5H,2-3H2,1H3 |
| InChIKey | RGPMKUKZXZXPAS-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 132.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.58 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|