C20H15ClF2N2O — CID 144505155
N-[1-[3-(4-chlorophenyl)-2-pyridinyl]-2-(3,5-difluorophenyl)ethyl]formamide (PubChem CID 144505155) has the molecular formula C20H15ClF2N2O and a molecular weight of 372.80 g/mol. Its IUPAC name is N-[1-[3-(4-chlorophenyl)-2-pyridinyl]-2-(3,5-difluorophenyl)ethyl]formamide.
| Compound Name | N-[1-[3-(4-chlorophenyl)-2-pyridinyl]-2-(3,5-difluorophenyl)ethyl]formamide |
|---|---|
| PubChem CID | 144505155 |
| Molecular Formula | C20H15ClF2N2O |
| Molecular Weight | 372.80 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | N-[1-[3-(4-chlorophenyl)-2-pyridinyl]-2-(3,5-difluorophenyl)ethyl]formamide |
| SMILES | O=CNC(Cc1cc(F)cc(F)c1)c1ncccc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H15ClF2N2O/c21-15-5-3-14(4-6-15)18-2-1-7-24-20(18)19(25-12-26)10-13-8-16(22)11-17(23)9-13/h1-9,11-12,19H,10H2,(H,25,26) |
| InChIKey | UAQHCVVGYTYZMN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.80 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|