C22H25N3 — CID 144670467
8-[3,5-di(propan-2-yl)cyclohexa-1,5-dien-1-yl]-4,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 144670467) has the molecular formula C22H25N3 and a molecular weight of 331.46 g/mol. Its IUPAC name is 8-[3,5-di(propan-2-yl)cyclohexa-1,5-dien-1-yl]-4,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 8-[3,5-di(propan-2-yl)cyclohexa-1,5-dien-1-yl]-4,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 144670467 |
| Molecular Formula | C22H25N3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 8-[3,5-di(propan-2-yl)cyclohexa-1,5-dien-1-yl]-4,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | CC(C)C1=CC(n2c3ccncc3c3cnccc32)=CC(C(C)C)C1 |
| InChI | InChI=1S/C22H25N3/c1-14(2)16-9-17(15(3)4)11-18(10-16)25-21-5-7-23-12-19(21)20-13-24-8-6-22(20)25/h5-8,10-16H,9H2,1-4H3 |
| InChIKey | ABZQSPAUTXYQSK-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |