C31H29N — CID 144671031
9,9-dimethyl-7-(1-methylcyclopropyl)-N-(4-phenylphenyl)fluoren-2-amine (PubChem CID 144671031) has the molecular formula C31H29N and a molecular weight of 415.58 g/mol. Its IUPAC name is 9,9-dimethyl-7-(1-methylcyclopropyl)-N-(4-phenylphenyl)fluoren-2-amine.
| Compound Name | 9,9-dimethyl-7-(1-methylcyclopropyl)-N-(4-phenylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 144671031 |
| Molecular Formula | C31H29N |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 9,9-dimethyl-7-(1-methylcyclopropyl)-N-(4-phenylphenyl)fluoren-2-amine |
| SMILES | CC1(c2ccc3c(c2)C(C)(C)c2cc(Nc4ccc(-c5ccccc5)cc4)ccc2-3)CC1 |
| InChI | InChI=1S/C31H29N/c1-30(2)28-19-23(31(3)17-18-31)11-15-26(28)27-16-14-25(20-29(27)30)32-24-12-9-22(10-13-24)21-7-5-4-6-8-21/h4-16,19-20,32H,17-18H2,1-3H3 |
| InChIKey | IUYSRSCZRGVZTC-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |