C25H24ClN3O4S — CID 144671207
5-[(3-chlorophenyl)methyl]-N-[2-(methoxyamino)ethyl]-11-methylidene-6,11-dioxobenzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 144671207) has the molecular formula C25H24ClN3O4S and a molecular weight of 498.00 g/mol. Its IUPAC name is 5-[(3-chlorophenyl)methyl]-N-[2-(methoxyamino)ethyl]-11-methylidene-6,11-dioxobenzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | 5-[(3-chlorophenyl)methyl]-N-[2-(methoxyamino)ethyl]-11-methylidene-6,11-dioxobenzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 144671207 |
| Molecular Formula | C25H24ClN3O4S |
| Molecular Weight | 498.00 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 5-[(3-chlorophenyl)methyl]-N-[2-(methoxyamino)ethyl]-11-methylidene-6,11-dioxobenzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | C=S1(=O)c2ccccc2C(=O)N(Cc2cccc(Cl)c2)c2cc(C(=O)NCCNOC)ccc21 |
| InChI | InChI=1S/C25H24ClN3O4S/c1-33-28-13-12-27-24(30)18-10-11-23-21(15-18)29(16-17-6-5-7-19(26)14-17)25(31)20-8-3-4-9-22(20)34(23,2)32/h3-11,14-15,28H,2,12-13,16H2,1H3,(H,27,30) |
| InChIKey | WYTWMHXSDGLGAG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.00 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|